C20H22FN3O4 — CID 176988423
2-cyanopropanamide;5-fluoro-N-[[4-(hydroxymethyl)phenyl]methyl]-2-methoxybenzamide (PubChem CID 176988423) has the molecular formula C20H22FN3O4 and a molecular weight of 387.41 g/mol. Its IUPAC name is 2-cyanopropanamide;5-fluoro-N-[[4-(hydroxymethyl)phenyl]methyl]-2-methoxybenzamide.
| Compound Name | 2-cyanopropanamide;5-fluoro-N-[[4-(hydroxymethyl)phenyl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 176988423 |
| Molecular Formula | C20H22FN3O4 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-cyanopropanamide;5-fluoro-N-[[4-(hydroxymethyl)phenyl]methyl]-2-methoxybenzamide |
| SMILES | CC(C#N)C(N)=O.COc1ccc(F)cc1C(=O)NCc1ccc(CO)cc1 |
| InChI | InChI=1S/C16H16FNO3.C4H6N2O/c1-21-15-7-6-13(17)8-14(15)16(20)18-9-11-2-4-12(10-19)5-3-11;1-3(2-5)4(6)7/h2-8,19H,9-10H2,1H3,(H,18,20);3H,1H3,(H2,6,7) |
| InChIKey | WPQAVIYRSTYZHR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 125.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |