C21H17ClFN3O3 — CID 164900727
6-chloro-2-[4-[[(5-fluoro-2-methoxybenzoyl)amino]methyl]phenyl]pyridine-3-carboxamide (PubChem CID 164900727) has the molecular formula C21H17ClFN3O3 and a molecular weight of 413.84 g/mol. Its IUPAC name is 6-chloro-2-[4-[[(5-fluoro-2-methoxybenzoyl)amino]methyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-2-[4-[[(5-fluoro-2-methoxybenzoyl)amino]methyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164900727 |
| Molecular Formula | C21H17ClFN3O3 |
| Molecular Weight | 413.84 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 6-chloro-2-[4-[[(5-fluoro-2-methoxybenzoyl)amino]methyl]phenyl]pyridine-3-carboxamide |
| SMILES | COc1ccc(F)cc1C(=O)NCc1ccc(-c2nc(Cl)ccc2C(N)=O)cc1 |
| InChI | InChI=1S/C21H17ClFN3O3/c1-29-17-8-6-14(23)10-16(17)21(28)25-11-12-2-4-13(5-3-12)19-15(20(24)27)7-9-18(22)26-19/h2-10H,11H2,1H3,(H2,24,27)(H,25,28) |
| InChIKey | TXRUXUFGVKJHKW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.84 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|