C15H15N7O3 — CID 176989467
[(2R)-2-(aminomethoxy)aziridin-1-yl]-[2-[[5-(triazol-2-yl)-2-pyridinyl]methyl]-1,3-oxazol-4-yl]methanone (PubChem CID 176989467) has the molecular formula C15H15N7O3 and a molecular weight of 341.33 g/mol. Its IUPAC name is [(2R)-2-(aminomethoxy)aziridin-1-yl]-[2-[[5-(triazol-2-yl)-2-pyridinyl]methyl]-1,3-oxazol-4-yl]methanone.
| Compound Name | [(2R)-2-(aminomethoxy)aziridin-1-yl]-[2-[[5-(triazol-2-yl)-2-pyridinyl]methyl]-1,3-oxazol-4-yl]methanone |
|---|---|
| PubChem CID | 176989467 |
| Molecular Formula | C15H15N7O3 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | [(2R)-2-(aminomethoxy)aziridin-1-yl]-[2-[[5-(triazol-2-yl)-2-pyridinyl]methyl]-1,3-oxazol-4-yl]methanone |
| SMILES | NCO[C@@H]1CN1C(=O)c1coc(Cc2ccc(-n3nccn3)cn2)n1 |
| InChI | InChI=1S/C15H15N7O3/c16-9-25-14-7-21(14)15(23)12-8-24-13(20-12)5-10-1-2-11(6-17-10)22-18-3-4-19-22/h1-4,6,8,14H,5,7,9,16H2/t14-,21?/m1/s1 |
| InChIKey | PGUNRTRDEZBTAF-CKAQCJTGSA-N |
| XLogP | -0.04 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|