C15H14N6O3 — CID 176989599
N-(1-hydroxycyclopropyl)-2-[[5-(triazol-2-yl)-2-pyridinyl]methyl]-1,3-oxazole-4-carboxamide (PubChem CID 176989599) has the molecular formula C15H14N6O3 and a molecular weight of 326.32 g/mol. Its IUPAC name is N-(1-hydroxycyclopropyl)-2-[[5-(triazol-2-yl)-2-pyridinyl]methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(1-hydroxycyclopropyl)-2-[[5-(triazol-2-yl)-2-pyridinyl]methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 176989599 |
| Molecular Formula | C15H14N6O3 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | N-(1-hydroxycyclopropyl)-2-[[5-(triazol-2-yl)-2-pyridinyl]methyl]-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NC1(O)CC1)c1coc(Cc2ccc(-n3nccn3)cn2)n1 |
| InChI | InChI=1S/C15H14N6O3/c22-14(20-15(23)3-4-15)12-9-24-13(19-12)7-10-1-2-11(8-16-10)21-17-5-6-18-21/h1-2,5-6,8-9,23H,3-4,7H2,(H,20,22) |
| InChIKey | XUKSNEASMSJHIL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|