C25H29N5 — CID 176990733
(5S)-3-[2-[[(S)-phenyl-[(3R)-1,2,3,4-tetrahydro-1,5-naphthyridin-3-yl]methyl]amino]ethyl]-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine (PubChem CID 176990733) has the molecular formula C25H29N5 and a molecular weight of 399.54 g/mol. Its IUPAC name is (5S)-3-[2-[[(S)-phenyl-[(3R)-1,2,3,4-tetrahydro-1,5-naphthyridin-3-yl]methyl]amino]ethyl]-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine.
| Compound Name | (5S)-3-[2-[[(S)-phenyl-[(3R)-1,2,3,4-tetrahydro-1,5-naphthyridin-3-yl]methyl]amino]ethyl]-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine |
|---|---|
| PubChem CID | 176990733 |
| Molecular Formula | C25H29N5 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | (5S)-3-[2-[[(S)-phenyl-[(3R)-1,2,3,4-tetrahydro-1,5-naphthyridin-3-yl]methyl]amino]ethyl]-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine |
| SMILES | N[C@H]1CCc2ncc(CCN[C@H](c3ccccc3)[C@H]3CNc4cccnc4C3)cc21 |
| InChI | InChI=1S/C25H29N5/c26-21-8-9-22-20(21)13-17(15-29-22)10-12-28-25(18-5-2-1-3-6-18)19-14-24-23(30-16-19)7-4-11-27-24/h1-7,11,13,15,19,21,25,28,30H,8-10,12,14,16,26H2/t19-,21+,25-/m1/s1 |
| InChIKey | NWDIQAWZSZHMGG-FZOAFFARSA-N |
| XLogP | 3.58 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |