C26H27F2N3O2 — CID 176990759
2-[3-fluoro-5-[(2S)-1-[[(S)-[(3S)-7-fluoro-1,2,3,4-tetrahydro-1,5-naphthyridin-3-yl]-phenylmethyl]amino]propan-2-yl]phenyl]acetic acid (PubChem CID 176990759) has the molecular formula C26H27F2N3O2 and a molecular weight of 451.52 g/mol. Its IUPAC name is 2-[3-fluoro-5-[(2S)-1-[[(S)-[(3S)-7-fluoro-1,2,3,4-tetrahydro-1,5-naphthyridin-3-yl]-phenylmethyl]amino]propan-2-yl]phenyl]acetic acid.
| Compound Name | 2-[3-fluoro-5-[(2S)-1-[[(S)-[(3S)-7-fluoro-1,2,3,4-tetrahydro-1,5-naphthyridin-3-yl]-phenylmethyl]amino]propan-2-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 176990759 |
| Molecular Formula | C26H27F2N3O2 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 2-[3-fluoro-5-[(2S)-1-[[(S)-[(3S)-7-fluoro-1,2,3,4-tetrahydro-1,5-naphthyridin-3-yl]-phenylmethyl]amino]propan-2-yl]phenyl]acetic acid |
| SMILES | C[C@H](CN[C@H](c1ccccc1)[C@@H]1CNc2cc(F)cnc2C1)c1cc(F)cc(CC(=O)O)c1 |
| InChI | InChI=1S/C26H27F2N3O2/c1-16(19-7-17(9-25(32)33)8-21(27)10-19)13-31-26(18-5-3-2-4-6-18)20-11-23-24(29-14-20)12-22(28)15-30-23/h2-8,10,12,15-16,20,26,29,31H,9,11,13-14H2,1H3,(H,32,33)/t16-,20+,26-/m1/s1 |
| InChIKey | CNOMLQPEZYBKHT-MKVPFSFESA-N |
| XLogP | 4.71 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |