C17H19N5 — CID 176991303
4-[2-[[(3S)-1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-3-yl]methylamino]ethyl]benzonitrile (PubChem CID 176991303) has the molecular formula C17H19N5 and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-[2-[[(3S)-1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-3-yl]methylamino]ethyl]benzonitrile.
| Compound Name | 4-[2-[[(3S)-1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-3-yl]methylamino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 176991303 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 4-[2-[[(3S)-1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-3-yl]methylamino]ethyl]benzonitrile |
| SMILES | N#Cc1ccc(CCNC[C@H]2CNc3cccnc3N2)cc1 |
| InChI | InChI=1S/C17H19N5/c18-10-14-5-3-13(4-6-14)7-9-19-11-15-12-21-16-2-1-8-20-17(16)22-15/h1-6,8,15,19,21H,7,9,11-12H2,(H,20,22)/t15-/m0/s1 |
| InChIKey | UVJOUWXTIIOWEO-HNNXBMFYSA-N |
| XLogP | 1.99 |
| TPSA | 72.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|