C25H28N4O3 — CID 176991790
2-[4-phenylmethoxy-3-[2-[[(3S)-1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-3-yl]methylamino]ethyl]phenyl]acetic acid (PubChem CID 176991790) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-[4-phenylmethoxy-3-[2-[[(3S)-1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-3-yl]methylamino]ethyl]phenyl]acetic acid.
| Compound Name | 2-[4-phenylmethoxy-3-[2-[[(3S)-1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-3-yl]methylamino]ethyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 176991790 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 2-[4-phenylmethoxy-3-[2-[[(3S)-1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-3-yl]methylamino]ethyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(OCc2ccccc2)c(CCNC[C@H]2CNc3cccnc3N2)c1 |
| InChI | InChI=1S/C25H28N4O3/c30-24(31)14-19-8-9-23(32-17-18-5-2-1-3-6-18)20(13-19)10-12-26-15-21-16-28-22-7-4-11-27-25(22)29-21/h1-9,11,13,21,26,28H,10,12,14-17H2,(H,27,29)(H,30,31)/t21-/m0/s1 |
| InChIKey | JTAPRPHKDKSGMZ-NRFANRHFSA-N |
| XLogP | 3.33 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|