C16H16ClNO2 — CID 174489903
N-[2-(5-chloro-2-phenylmethoxyphenyl)ethyl]formamide (PubChem CID 174489903) has the molecular formula C16H16ClNO2 and a molecular weight of 289.76 g/mol. Its IUPAC name is N-[2-(5-chloro-2-phenylmethoxyphenyl)ethyl]formamide.
| Compound Name | N-[2-(5-chloro-2-phenylmethoxyphenyl)ethyl]formamide |
|---|---|
| PubChem CID | 174489903 |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-[2-(5-chloro-2-phenylmethoxyphenyl)ethyl]formamide |
| SMILES | O=CNCCc1cc(Cl)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C16H16ClNO2/c17-15-6-7-16(14(10-15)8-9-18-12-19)20-11-13-4-2-1-3-5-13/h1-7,10,12H,8-9,11H2,(H,18,19) |
| InChIKey | NUZJEZLIZFVIPH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|