C19H19Cl2NO4 — CID 22681654
4-[2-[5-chloro-2-[(3-chlorophenyl)methoxy]phenyl]ethylamino]-4-oxobutanoic acid (PubChem CID 22681654) has the molecular formula C19H19Cl2NO4 and a molecular weight of 396.27 g/mol. Its IUPAC name is 4-[2-[5-chloro-2-[(3-chlorophenyl)methoxy]phenyl]ethylamino]-4-oxobutanoic acid.
| Compound Name | 4-[2-[5-chloro-2-[(3-chlorophenyl)methoxy]phenyl]ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22681654 |
| Molecular Formula | C19H19Cl2NO4 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 4-[2-[5-chloro-2-[(3-chlorophenyl)methoxy]phenyl]ethylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NCCc1cc(Cl)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H19Cl2NO4/c20-15-3-1-2-13(10-15)12-26-17-5-4-16(21)11-14(17)8-9-22-18(23)6-7-19(24)25/h1-5,10-11H,6-9,12H2,(H,22,23)(H,24,25) |
| InChIKey | GZXFIWIXZKNXCR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |