C26H25N5O2 — CID 176991480
4-[2-[[(3R)-7-(7-methoxy-1H-indol-2-yl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-3-yl]methylamino]ethyl]benzonitrile (PubChem CID 176991480) has the molecular formula C26H25N5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 4-[2-[[(3R)-7-(7-methoxy-1H-indol-2-yl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-3-yl]methylamino]ethyl]benzonitrile.
| Compound Name | 4-[2-[[(3R)-7-(7-methoxy-1H-indol-2-yl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-3-yl]methylamino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 176991480 |
| Molecular Formula | C26H25N5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 4-[2-[[(3R)-7-(7-methoxy-1H-indol-2-yl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-3-yl]methylamino]ethyl]benzonitrile |
| SMILES | COc1cccc2cc(-c3cnc4c(c3)NC[C@@H](CNCCc3ccc(C#N)cc3)O4)[nH]c12 |
| InChI | InChI=1S/C26H25N5O2/c1-32-24-4-2-3-19-11-22(31-25(19)24)20-12-23-26(30-14-20)33-21(16-29-23)15-28-10-9-17-5-7-18(13-27)8-6-17/h2-8,11-12,14,21,28-29,31H,9-10,15-16H2,1H3/t21-/m1/s1 |
| InChIKey | UTQSAMHJQMEKKX-OAQYLSRUSA-N |
| XLogP | 4.12 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|