C28H28N6O2 — CID 176991540
4-[2-[[7-(2,1,3-benzoxadiazol-5-yl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-3-yl]methylamino]ethyl]benzonitrile;(3Z)-penta-1,3-diene (PubChem CID 176991540) has the molecular formula C28H28N6O2 and a molecular weight of 480.57 g/mol. Its IUPAC name is 4-[2-[[7-(2,1,3-benzoxadiazol-5-yl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-3-yl]methylamino]ethyl]benzonitrile;(3Z)-penta-1,3-diene.
| Compound Name | 4-[2-[[7-(2,1,3-benzoxadiazol-5-yl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-3-yl]methylamino]ethyl]benzonitrile;(3Z)-penta-1,3-diene |
|---|---|
| PubChem CID | 176991540 |
| Molecular Formula | C28H28N6O2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 4-[2-[[7-(2,1,3-benzoxadiazol-5-yl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-3-yl]methylamino]ethyl]benzonitrile;(3Z)-penta-1,3-diene |
| SMILES | C=C/C=C\C.N#Cc1ccc(CCNCC2CNc3cc(-c4ccc5nonc5c4)cnc3O2)cc1 |
| InChI | InChI=1S/C23H20N6O2.C5H8/c24-11-16-3-1-15(2-4-16)7-8-25-13-19-14-26-22-10-18(12-27-23(22)30-19)17-5-6-20-21(9-17)29-31-28-20;1-3-5-4-2/h1-6,9-10,12,19,25-26H,7-8,13-14H2;3-5H,1H2,2H3/b;5-4- |
| InChIKey | JPFZTWQAYMUXGJ-GUHKXDMSSA-N |
| XLogP | 4.91 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|