C29H32F4N8O — CID 176991993
6-[4-(1-ethenyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-4-fluoro-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 176991993) has the molecular formula C29H32F4N8O and a molecular weight of 584.62 g/mol. Its IUPAC name is 6-[4-(1-ethenyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-4-fluoro-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-[4-(1-ethenyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-4-fluoro-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 176991993 |
| Molecular Formula | C29H32F4N8O |
| Molecular Weight | 584.62 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | 6-[4-(1-ethenyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-4-fluoro-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | C=CC12CCC(CN(c3nc(OCC45CCCN4CCC5)nc4cc(-c5nc(N)cc(F)c5C(F)(F)F)ncc34)C1)N2 |
| InChI | InChI=1S/C29H32F4N8O/c1-2-27-8-5-17(39-27)14-40(15-27)25-18-13-35-21(24-23(29(31,32)33)19(30)11-22(34)37-24)12-20(18)36-26(38-25)42-16-28-6-3-9-41(28)10-4-7-28/h2,11-13,17,39H,1,3-10,14-16H2,(H2,34,37) |
| InChIKey | ILFIHTWNZZCINY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|