C28H31F4N7O — CID 166102764
6-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 166102764) has the molecular formula C28H31F4N7O and a molecular weight of 557.60 g/mol. Its IUPAC name is 6-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 166102764 |
| Molecular Formula | C28H31F4N7O |
| Molecular Weight | 557.60 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | 6-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | Nc1ccc(C(F)(F)F)c(-c2ccc3c(N4CC5CCC(C4)N5)nc(OCC45CCCN4CCC5)nc3c2F)n1 |
| InChI | InChI=1S/C28H31F4N7O/c29-22-18(23-20(28(30,31)32)7-8-21(33)35-23)5-6-19-24(22)36-26(40-15-27-9-1-11-39(27)12-2-10-27)37-25(19)38-13-16-3-4-17(14-38)34-16/h5-8,16-17,34H,1-4,9-15H2,(H2,33,35) |
| InChIKey | FWTIACRHKLQGTH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |