C8H15N3O3 — CID 176992092
3-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide;molecular hydrogen (PubChem CID 176992092) has the molecular formula C8H15N3O3 and a molecular weight of 201.23 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide;molecular hydrogen.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide;molecular hydrogen |
|---|---|
| PubChem CID | 176992092 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide;molecular hydrogen |
| SMILES | CNNC(=O)CCN1C(=O)C=CC1=O.[H][H].[H][H] |
| InChI | InChI=1S/C8H11N3O3.2H2/c1-9-10-6(12)4-5-11-7(13)2-3-8(11)14;;/h2-3,9H,4-5H2,1H3,(H,10,12);2*1H |
| InChIKey | CRBFUUQMZIKMBN-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|