C7H9N3O3 — CID 597095
3-(3,6-dioxo-1H-pyridazin-2-yl)propanamide (PubChem CID 597095) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is 3-(3,6-dioxo-1H-pyridazin-2-yl)propanamide.
| Compound Name | 3-(3,6-dioxo-1H-pyridazin-2-yl)propanamide |
|---|---|
| PubChem CID | 597095 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 3-(3,6-dioxo-1H-pyridazin-2-yl)propanamide |
| SMILES | NC(=O)CCn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C7H9N3O3/c8-5(11)3-4-10-7(13)2-1-6(12)9-10/h1-2H,3-4H2,(H2,8,11)(H,9,12) |
| InChIKey | AAYKONFWPMOCCN-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |