C8H10N2O3 — CID 587202
2-(3-oxobutyl)-1H-pyridazine-3,6-dione (PubChem CID 587202) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 2-(3-oxobutyl)-1H-pyridazine-3,6-dione.
| Compound Name | 2-(3-oxobutyl)-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 587202 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 2-(3-oxobutyl)-1H-pyridazine-3,6-dione |
| SMILES | CC(=O)CCn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C8H10N2O3/c1-6(11)4-5-10-8(13)3-2-7(12)9-10/h2-3H,4-5H2,1H3,(H,9,12) |
| InChIKey | XSZIAVBBNVOJRF-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |