C9H14N4O3 — CID 9179928
3-(3,6-dioxo-1H-pyridazin-2-yl)-N',N'-dimethylpropanehydrazide (PubChem CID 9179928) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is 3-(3,6-dioxo-1H-pyridazin-2-yl)-N',N'-dimethylpropanehydrazide.
| Compound Name | 3-(3,6-dioxo-1H-pyridazin-2-yl)-N',N'-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 9179928 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 3-(3,6-dioxo-1H-pyridazin-2-yl)-N',N'-dimethylpropanehydrazide |
| SMILES | CN(C)NC(=O)CCn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C9H14N4O3/c1-12(2)10-8(15)5-6-13-9(16)4-3-7(14)11-13/h3-4H,5-6H2,1-2H3,(H,10,15)(H,11,14) |
| InChIKey | PXZNDCKDZIZRID-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|