C9H14N2O2 — CID 70599423
2-pentyl-1H-pyridazine-3,6-dione (PubChem CID 70599423) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-pentyl-1H-pyridazine-3,6-dione.
| Compound Name | 2-pentyl-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 70599423 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2-pentyl-1H-pyridazine-3,6-dione |
| SMILES | CCCCCn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C9H14N2O2/c1-2-3-4-7-11-9(13)6-5-8(12)10-11/h5-6H,2-4,7H2,1H3,(H,10,12) |
| InChIKey | BISSLGYDSBNTFO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|