C11H20N3O2+ — CID 67360795
1,2-dihydropyridazine-3,6-dione;1,1-dimethylpiperidin-1-ium (PubChem CID 67360795) has the molecular formula C11H20N3O2+ and a molecular weight of 226.30 g/mol. Its IUPAC name is 1,2-dihydropyridazine-3,6-dione;1,1-dimethylpiperidin-1-ium.
| Compound Name | 1,2-dihydropyridazine-3,6-dione;1,1-dimethylpiperidin-1-ium |
|---|---|
| PubChem CID | 67360795 |
| Molecular Formula | C11H20N3O2+ |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 1,2-dihydropyridazine-3,6-dione;1,1-dimethylpiperidin-1-ium |
| SMILES | C[N+]1(C)CCCCC1.O=c1ccc(=O)[nH][nH]1 |
| InChI | InChI=1S/C7H16N.C4H4N2O2/c1-8(2)6-4-3-5-7-8;7-3-1-2-4(8)6-5-3/h3-7H2,1-2H3;1-2H,(H,5,7)(H,6,8)/q+1; |
| InChIKey | JMIAHCMXKYBDMK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|