C7H10N2O2 — CID 39848286
2-propyl-1H-pyridazine-3,6-dione (PubChem CID 39848286) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 2-propyl-1H-pyridazine-3,6-dione.
| Compound Name | 2-propyl-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 39848286 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 2-propyl-1H-pyridazine-3,6-dione |
| SMILES | CCCn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C7H10N2O2/c1-2-5-9-7(11)4-3-6(10)8-9/h3-4H,2,5H2,1H3,(H,8,10) |
| InChIKey | CXSVZLMHGDTLTL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |