C6H5F3N2O2 — CID 138715541
2-(2,2,2-trifluoroethyl)-1H-pyridazine-3,6-dione (PubChem CID 138715541) has the molecular formula C6H5F3N2O2 and a molecular weight of 194.11 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethyl)-1H-pyridazine-3,6-dione.
| Compound Name | 2-(2,2,2-trifluoroethyl)-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 138715541 |
| Molecular Formula | C6H5F3N2O2 |
| Molecular Weight | 194.11 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 2-(2,2,2-trifluoroethyl)-1H-pyridazine-3,6-dione |
| SMILES | O=c1ccc(=O)n(CC(F)(F)F)[nH]1 |
| InChI | InChI=1S/C6H5F3N2O2/c7-6(8,9)3-11-5(13)2-1-4(12)10-11/h1-2H,3H2,(H,10,12) |
| InChIKey | FDQWTXRWILFMMJ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.11 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |