C8H10F3N3O2 — CID 43753206
2-(4-amino-1,1,1-trifluorobutan-2-yl)-1H-pyridazine-3,6-dione (PubChem CID 43753206) has the molecular formula C8H10F3N3O2 and a molecular weight of 237.18 g/mol. Its IUPAC name is 2-(4-amino-1,1,1-trifluorobutan-2-yl)-1H-pyridazine-3,6-dione.
| Compound Name | 2-(4-amino-1,1,1-trifluorobutan-2-yl)-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 43753206 |
| Molecular Formula | C8H10F3N3O2 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 2-(4-amino-1,1,1-trifluorobutan-2-yl)-1H-pyridazine-3,6-dione |
| SMILES | NCCC(n1[nH]c(=O)ccc1=O)C(F)(F)F |
| InChI | InChI=1S/C8H10F3N3O2/c9-8(10,11)5(3-4-12)14-7(16)2-1-6(15)13-14/h1-2,5H,3-4,12H2,(H,13,15) |
| InChIKey | JYYBAZRTNYPPDV-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |