C6H7BrN2O2 — CID 24688547
2-(2-bromoethyl)-1H-pyridazine-3,6-dione (PubChem CID 24688547) has the molecular formula C6H7BrN2O2 and a molecular weight of 219.04 g/mol. Its IUPAC name is 2-(2-bromoethyl)-1H-pyridazine-3,6-dione.
| Compound Name | 2-(2-bromoethyl)-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 24688547 |
| Molecular Formula | C6H7BrN2O2 |
| Molecular Weight | 219.04 g/mol |
| Exact Mass | 217.97 |
| IUPAC Name | 2-(2-bromoethyl)-1H-pyridazine-3,6-dione |
| SMILES | O=c1ccc(=O)n(CCBr)[nH]1 |
| InChI | InChI=1S/C6H7BrN2O2/c7-3-4-9-6(11)2-1-5(10)8-9/h1-2H,3-4H2,(H,8,10) |
| InChIKey | XPEDBBXMRKYWGA-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.04 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|