C6H5N3O2 — CID 24706856
2-(3,6-dioxo-1H-pyridazin-2-yl)acetonitrile (PubChem CID 24706856) has the molecular formula C6H5N3O2 and a molecular weight of 151.12 g/mol. Its IUPAC name is 2-(3,6-dioxo-1H-pyridazin-2-yl)acetonitrile.
| Compound Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)acetonitrile |
|---|---|
| PubChem CID | 24706856 |
| Molecular Formula | C6H5N3O2 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)acetonitrile |
| SMILES | N#CCn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C6H5N3O2/c7-3-4-9-6(11)2-1-5(10)8-9/h1-2H,4H2,(H,8,10) |
| InChIKey | IYILNTXCUCGKBC-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |