About CID 58044780
CID 58044780 (PubChem CID 58044780) has the molecular formula C6H8N3O2
and a molecular weight of 154.15 g/mol.
Molecular Properties
| Compound Name | CID 58044780 |
| PubChem CID | 58044780 |
| Molecular Formula | C6H8N3O2 |
| Molecular Weight | 154.15 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | — |
| SMILES | [NH]CCn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C6H8N3O2/c7-3-4-9-6(11)2-1-5(10)8-9/h1-2,7H,3-4H2,(H,8,10) |
| InChIKey | MUDUVORPGCREDO-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.15 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 58044780 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58044780?
The IUPAC name of CID 58044780 (CID 58044780) is not available.
What is the SMILES notation for CID 58044780?
The canonical SMILES for CID 58044780 is [NH]CCn1[nH]c(=O)ccc1=O.
What is the InChIKey of CID 58044780?
The InChIKey is MUDUVORPGCREDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N3O2/c7-3-4-9-6(11)2-1-5(10)8-9/h1-2,7H,3-4H2,(H,8,10).
What are the key properties of CID 58044780?
CID 58044780 has a molecular weight of 154.15 g/mol, XLogP of -1.18, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58044780 is sourced from PubChem (CID 58044780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).