C7H9N3O2S — CID 12787568
3-(3,6-dioxo-1H-pyridazin-2-yl)propanethioamide (PubChem CID 12787568) has the molecular formula C7H9N3O2S and a molecular weight of 199.24 g/mol. Its IUPAC name is 3-(3,6-dioxo-1H-pyridazin-2-yl)propanethioamide.
| Compound Name | 3-(3,6-dioxo-1H-pyridazin-2-yl)propanethioamide |
|---|---|
| PubChem CID | 12787568 |
| Molecular Formula | C7H9N3O2S |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 3-(3,6-dioxo-1H-pyridazin-2-yl)propanethioamide |
| SMILES | NC(=S)CCn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C7H9N3O2S/c8-5(13)3-4-10-7(12)2-1-6(11)9-10/h1-2H,3-4H2,(H2,8,13)(H,9,11) |
| InChIKey | KJXLNMVQIZZAKR-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|