C8H10N2O2 — CID 46299433
2-(2-methylprop-2-enyl)-1H-pyridazine-3,6-dione (PubChem CID 46299433) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-(2-methylprop-2-enyl)-1H-pyridazine-3,6-dione.
| Compound Name | 2-(2-methylprop-2-enyl)-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 46299433 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 2-(2-methylprop-2-enyl)-1H-pyridazine-3,6-dione |
| SMILES | C=C(C)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C8H10N2O2/c1-6(2)5-10-8(12)4-3-7(11)9-10/h3-4H,1,5H2,2H3,(H,9,11) |
| InChIKey | LHPSYBCLKLYVTD-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|