C28H31F3N6O2S — CID 176992397
4-[3-[11,11-difluoro-5-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-12-thia-3,13-diazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-2-yl]prop-2-ynylamino]-3-methoxy-N-methylbenzamide (PubChem CID 176992397) has the molecular formula C28H31F3N6O2S and a molecular weight of 572.66 g/mol. Its IUPAC name is 4-[3-[11,11-difluoro-5-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-12-thia-3,13-diazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-2-yl]prop-2-ynylamino]-3-methoxy-N-methylbenzamide.
| Compound Name | 4-[3-[11,11-difluoro-5-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-12-thia-3,13-diazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-2-yl]prop-2-ynylamino]-3-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 176992397 |
| Molecular Formula | C28H31F3N6O2S |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | 4-[3-[11,11-difluoro-5-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-12-thia-3,13-diazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-2-yl]prop-2-ynylamino]-3-methoxy-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(NCC#Cc2nc3c(N[C@@H]4CCN(C)C[C@@H]4F)ccc4n3c2SC(F)(F)CC4)c(OC)c1 |
| InChI | InChI=1S/C28H31F3N6O2S/c1-32-26(38)17-6-8-21(24(15-17)39-3)33-13-4-5-23-27-37-18(10-12-28(30,31)40-27)7-9-22(25(37)35-23)34-20-11-14-36(2)16-19(20)29/h6-9,15,19-20,33-34H,10-14,16H2,1-3H3,(H,32,38)/t19-,20+/m0/s1 |
| InChIKey | GZSDTKWMQABPOP-VQTJNVASSA-N |
| XLogP | 4.25 |
| TPSA | 82.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|