C28H32F4N6O — CID 171531623
3-ethyl-4-[3-[8-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynylamino]-N-methylbenzamide (PubChem CID 171531623) has the molecular formula C28H32F4N6O and a molecular weight of 544.60 g/mol. Its IUPAC name is 3-ethyl-4-[3-[8-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynylamino]-N-methylbenzamide.
| Compound Name | 3-ethyl-4-[3-[8-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 171531623 |
| Molecular Formula | C28H32F4N6O |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 3-ethyl-4-[3-[8-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynylamino]-N-methylbenzamide |
| SMILES | CCc1cc(C(=O)NC)ccc1NCC#Cc1nc2c(N[C@@H]3CCN(C)C[C@@H]3F)cccn2c1CC(F)(F)F |
| InChI | InChI=1S/C28H32F4N6O/c1-4-18-15-19(27(39)33-2)9-10-21(18)34-12-5-7-23-25(16-28(30,31)32)38-13-6-8-24(26(38)36-23)35-22-11-14-37(3)17-20(22)29/h6,8-10,13,15,20,22,34-35H,4,11-12,14,16-17H2,1-3H3,(H,33,39)/t20-,22+/m0/s1 |
| InChIKey | ZDXVPBFIMPAYOQ-RBBKRZOGSA-N |
| XLogP | 4.28 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|