C27H29F5N6O2 — CID 178182324
2-[3-[6-fluoro-8-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynylamino]-3-methoxy-N-methylbenzamide (PubChem CID 178182324) has the molecular formula C27H29F5N6O2 and a molecular weight of 564.56 g/mol. Its IUPAC name is 2-[3-[6-fluoro-8-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynylamino]-3-methoxy-N-methylbenzamide.
| Compound Name | 2-[3-[6-fluoro-8-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynylamino]-3-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 178182324 |
| Molecular Formula | C27H29F5N6O2 |
| Molecular Weight | 564.56 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | 2-[3-[6-fluoro-8-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynylamino]-3-methoxy-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(OC)c1NCC#Cc1nc2c(N[C@@H]3CCN(C)C[C@@H]3F)cc(F)cn2c1CC(F)(F)F |
| InChI | InChI=1S/C27H29F5N6O2/c1-33-26(39)17-6-4-8-23(40-3)24(17)34-10-5-7-20-22(13-27(30,31)32)38-14-16(28)12-21(25(38)36-20)35-19-9-11-37(2)15-18(19)29/h4,6,8,12,14,18-19,34-35H,9-11,13,15H2,1-3H3,(H,33,39)/t18-,19+/m0/s1 |
| InChIKey | IGQSAWALTHEKGY-RBUKOAKNSA-N |
| XLogP | 3.86 |
| TPSA | 82.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|