About ethane;[2-[(Z)-pent-2-en-3-yl]-5-propan-2-ylphenyl] formate
ethane;[2-[(Z)-pent-2-en-3-yl]-5-propan-2-ylphenyl] formate (PubChem CID 176992667) has the molecular formula C17H26O2
and a molecular weight of 262.39 g/mol. Its IUPAC name is ethane;[2-[(Z)-pent-2-en-3-yl]-5-propan-2-ylphenyl] formate.
Molecular Properties
| Compound Name | ethane;[2-[(Z)-pent-2-en-3-yl]-5-propan-2-ylphenyl] formate |
| PubChem CID | 176992667 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | ethane;[2-[(Z)-pent-2-en-3-yl]-5-propan-2-ylphenyl] formate |
| SMILES | C/C=C(/CC)c1ccc(C(C)C)cc1OC=O.CC |
| InChI | InChI=1S/C15H20O2.C2H6/c1-5-12(6-2)14-8-7-13(11(3)4)9-15(14)17-10-16;1-2/h5,7-11H,6H2,1-4H3;1-2H3/b12-5-; |
| InChIKey | PBENWDCEHHEOGN-UHPXVVQNSA-N |
| XLogP | 5.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;[2-[(Z)-pent-2-en-3-yl]-5-propan-2-ylphenyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[2-[(Z)-pent-2-en-3-yl]-5-propan-2-ylphenyl] formate?
The IUPAC name of ethane;[2-[(Z)-pent-2-en-3-yl]-5-propan-2-ylphenyl] formate (CID 176992667) is ethane;[2-[(Z)-pent-2-en-3-yl]-5-propan-2-ylphenyl] formate.
What is the SMILES notation for ethane;[2-[(Z)-pent-2-en-3-yl]-5-propan-2-ylphenyl] formate?
The canonical SMILES for ethane;[2-[(Z)-pent-2-en-3-yl]-5-propan-2-ylphenyl] formate is C/C=C(/CC)c1ccc(C(C)C)cc1OC=O.CC.
What is the InChIKey of ethane;[2-[(Z)-pent-2-en-3-yl]-5-propan-2-ylphenyl] formate?
The InChIKey is PBENWDCEHHEOGN-UHPXVVQNSA-N. The full InChI is InChI=1S/C15H20O2.C2H6/c1-5-12(6-2)14-8-7-13(11(3)4)9-15(14)17-10-16;1-2/h5,7-11H,6H2,1-4H3;1-2H3/b12-5-;.
What are the key properties of ethane;[2-[(Z)-pent-2-en-3-yl]-5-propan-2-ylphenyl] formate?
ethane;[2-[(Z)-pent-2-en-3-yl]-5-propan-2-ylphenyl] formate has a molecular weight of 262.39 g/mol, XLogP of 5.18, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[2-[(Z)-pent-2-en-3-yl]-5-propan-2-ylphenyl] formate is sourced from PubChem (CID 176992667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).