C17H26 — CID 173285425
1-[(Z)-pent-2-en-3-yl]-3,5-di(propan-2-yl)benzene (PubChem CID 173285425) has the molecular formula C17H26 and a molecular weight of 230.39 g/mol. Its IUPAC name is 1-[(Z)-pent-2-en-3-yl]-3,5-di(propan-2-yl)benzene.
| Compound Name | 1-[(Z)-pent-2-en-3-yl]-3,5-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 173285425 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 1-[(Z)-pent-2-en-3-yl]-3,5-di(propan-2-yl)benzene |
| SMILES | C/C=C(/CC)c1cc(C(C)C)cc(C(C)C)c1 |
| InChI | InChI=1S/C17H26/c1-7-14(8-2)17-10-15(12(3)4)9-16(11-17)13(5)6/h7,9-13H,8H2,1-6H3/b14-7- |
| InChIKey | VOFRRRQYFPYWNT-AUWJEWJLSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |