C21H29N7O — CID 176993311
acetylene;6-(4-methyl-1,4-diazepan-1-yl)-N-[(Z)-5-methyliminopent-3-enyl]imidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 176993311) has the molecular formula C21H29N7O and a molecular weight of 395.51 g/mol. Its IUPAC name is acetylene;6-(4-methyl-1,4-diazepan-1-yl)-N-[(Z)-5-methyliminopent-3-enyl]imidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | acetylene;6-(4-methyl-1,4-diazepan-1-yl)-N-[(Z)-5-methyliminopent-3-enyl]imidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 176993311 |
| Molecular Formula | C21H29N7O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | acetylene;6-(4-methyl-1,4-diazepan-1-yl)-N-[(Z)-5-methyliminopent-3-enyl]imidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | C#C.C/N=C/C=C\CCNC(=O)c1cnc2ccc(N3CCCN(C)CC3)nn12 |
| InChI | InChI=1S/C19H27N7O.C2H2/c1-20-9-4-3-5-10-21-19(27)16-15-22-17-7-8-18(23-26(16)17)25-12-6-11-24(2)13-14-25;1-2/h3-4,7-9,15H,5-6,10-14H2,1-2H3,(H,21,27);1-2H/b4-3-,20-9+; |
| InChIKey | SUQBTALRONKQMD-DCINBGGISA-N |
| XLogP | 1.50 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|