C23H24F3N5O2S3 — CID 176993511
2-[methyl(methylsulfinyl)amino]-N-[4-[4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperazin-1-yl]sulfanylphenyl]benzamide (PubChem CID 176993511) has the molecular formula C23H24F3N5O2S3 and a molecular weight of 555.67 g/mol. Its IUPAC name is 2-[methyl(methylsulfinyl)amino]-N-[4-[4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperazin-1-yl]sulfanylphenyl]benzamide.
| Compound Name | 2-[methyl(methylsulfinyl)amino]-N-[4-[4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperazin-1-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 176993511 |
| Molecular Formula | C23H24F3N5O2S3 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.10 |
| IUPAC Name | 2-[methyl(methylsulfinyl)amino]-N-[4-[4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperazin-1-yl]sulfanylphenyl]benzamide |
| SMILES | CN(c1ccccc1C(=O)Nc1ccc(SN2CCN(c3nc(C(F)(F)F)cs3)CC2)cc1)S(C)=O |
| InChI | InChI=1S/C23H24F3N5O2S3/c1-29(36(2)33)19-6-4-3-5-18(19)21(32)27-16-7-9-17(10-8-16)35-31-13-11-30(12-14-31)22-28-20(15-34-22)23(24,25)26/h3-10,15H,11-14H2,1-2H3,(H,27,32) |
| InChIKey | UYBNNUBNCNNKIB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|