C14H17ClN4S2 — CID 176993476
4-[4-(4-chloro-1,3-thiazol-2-yl)piperazin-1-yl]sulfanyl-N-methylaniline (PubChem CID 176993476) has the molecular formula C14H17ClN4S2 and a molecular weight of 340.91 g/mol. Its IUPAC name is 4-[4-(4-chloro-1,3-thiazol-2-yl)piperazin-1-yl]sulfanyl-N-methylaniline.
| Compound Name | 4-[4-(4-chloro-1,3-thiazol-2-yl)piperazin-1-yl]sulfanyl-N-methylaniline |
|---|---|
| PubChem CID | 176993476 |
| Molecular Formula | C14H17ClN4S2 |
| Molecular Weight | 340.91 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 4-[4-(4-chloro-1,3-thiazol-2-yl)piperazin-1-yl]sulfanyl-N-methylaniline |
| SMILES | CNc1ccc(SN2CCN(c3nc(Cl)cs3)CC2)cc1 |
| InChI | InChI=1S/C14H17ClN4S2/c1-16-11-2-4-12(5-3-11)21-19-8-6-18(7-9-19)14-17-13(15)10-20-14/h2-5,10,16H,6-9H2,1H3 |
| InChIKey | QMTLSYJITULYQY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.91 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|