C18H20F3N3O3 — CID 176993985
5-methyl-N-[2-oxo-2-[4-(trifluoromethoxy)piperidin-1-yl]ethyl]-1H-indole-2-carboxamide (PubChem CID 176993985) has the molecular formula C18H20F3N3O3 and a molecular weight of 383.37 g/mol. Its IUPAC name is 5-methyl-N-[2-oxo-2-[4-(trifluoromethoxy)piperidin-1-yl]ethyl]-1H-indole-2-carboxamide.
| Compound Name | 5-methyl-N-[2-oxo-2-[4-(trifluoromethoxy)piperidin-1-yl]ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 176993985 |
| Molecular Formula | C18H20F3N3O3 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 5-methyl-N-[2-oxo-2-[4-(trifluoromethoxy)piperidin-1-yl]ethyl]-1H-indole-2-carboxamide |
| SMILES | Cc1ccc2[nH]c(C(=O)NCC(=O)N3CCC(OC(F)(F)F)CC3)cc2c1 |
| InChI | InChI=1S/C18H20F3N3O3/c1-11-2-3-14-12(8-11)9-15(23-14)17(26)22-10-16(25)24-6-4-13(5-7-24)27-18(19,20)21/h2-3,8-9,13,23H,4-7,10H2,1H3,(H,22,26) |
| InChIKey | LDFNTDDINWDNBM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |