C17H21FNOPS — CID 176995168
[4-[[[phosphanyl-(4-propan-2-yloxyphenyl)methyl]amino]methyl]phenyl] thiohypofluorite (PubChem CID 176995168) has the molecular formula C17H21FNOPS and a molecular weight of 337.40 g/mol. Its IUPAC name is [4-[[[phosphanyl-(4-propan-2-yloxyphenyl)methyl]amino]methyl]phenyl] thiohypofluorite.
| Compound Name | [4-[[[phosphanyl-(4-propan-2-yloxyphenyl)methyl]amino]methyl]phenyl] thiohypofluorite |
|---|---|
| PubChem CID | 176995168 |
| Molecular Formula | C17H21FNOPS |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | [4-[[[phosphanyl-(4-propan-2-yloxyphenyl)methyl]amino]methyl]phenyl] thiohypofluorite |
| SMILES | CC(C)Oc1ccc(C(P)NCc2ccc(SF)cc2)cc1 |
| InChI | InChI=1S/C17H21FNOPS/c1-12(2)20-15-7-5-14(6-8-15)17(21)19-11-13-3-9-16(22-18)10-4-13/h3-10,12,17,19H,11,21H2,1-2H3 |
| InChIKey | ZJGJBLIFQNUDGY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|