C11H18N4O2 — CID 176998080
5-N-ethyl-1-methyl-3-N-propan-2-ylpyrazole-3,5-dicarboxamide (PubChem CID 176998080) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 5-N-ethyl-1-methyl-3-N-propan-2-ylpyrazole-3,5-dicarboxamide.
| Compound Name | 5-N-ethyl-1-methyl-3-N-propan-2-ylpyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 176998080 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 5-N-ethyl-1-methyl-3-N-propan-2-ylpyrazole-3,5-dicarboxamide |
| SMILES | CCNC(=O)c1cc(C(=O)NC(C)C)nn1C |
| InChI | InChI=1S/C11H18N4O2/c1-5-12-11(17)9-6-8(14-15(9)4)10(16)13-7(2)3/h6-7H,5H2,1-4H3,(H,12,17)(H,13,16) |
| InChIKey | QZHNUUXWYAMEGF-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |