C16H26N4O3 — CID 56730562
N-butan-2-yl-1-methyl-5-(2-oxo-2-piperidin-1-ylethoxy)pyrazole-3-carboxamide (PubChem CID 56730562) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-butan-2-yl-1-methyl-5-(2-oxo-2-piperidin-1-ylethoxy)pyrazole-3-carboxamide.
| Compound Name | N-butan-2-yl-1-methyl-5-(2-oxo-2-piperidin-1-ylethoxy)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 56730562 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N-butan-2-yl-1-methyl-5-(2-oxo-2-piperidin-1-ylethoxy)pyrazole-3-carboxamide |
| SMILES | CCC(C)NC(=O)c1cc(OCC(=O)N2CCCCC2)n(C)n1 |
| InChI | InChI=1S/C16H26N4O3/c1-4-12(2)17-16(22)13-10-15(19(3)18-13)23-11-14(21)20-8-6-5-7-9-20/h10,12H,4-9,11H2,1-3H3,(H,17,22) |
| InChIKey | XNBXWAJCTIGTIX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |