C12H23NO — CID 177000265
(4aS)-4a-(methoxymethyl)-1,7a-dimethyl-2,3,4,5,6,7-hexahydrocyclopenta[b]pyridine (PubChem CID 177000265) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (4aS)-4a-(methoxymethyl)-1,7a-dimethyl-2,3,4,5,6,7-hexahydrocyclopenta[b]pyridine.
| Compound Name | (4aS)-4a-(methoxymethyl)-1,7a-dimethyl-2,3,4,5,6,7-hexahydrocyclopenta[b]pyridine |
|---|---|
| PubChem CID | 177000265 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (4aS)-4a-(methoxymethyl)-1,7a-dimethyl-2,3,4,5,6,7-hexahydrocyclopenta[b]pyridine |
| SMILES | COC[C@@]12CCCN(C)C1(C)CCC2 |
| InChI | InChI=1S/C12H23NO/c1-11-6-4-7-12(11,10-14-3)8-5-9-13(11)2/h4-10H2,1-3H3/t11?,12-/m1/s1 |
| InChIKey | WCPUXWXWKFVNNL-PIJUOVFKSA-N |
| XLogP | 2.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |