C9H19NO — CID 168881311
2-(1-methoxyethyl)-1,2-dimethylpyrrolidine (PubChem CID 168881311) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is 2-(1-methoxyethyl)-1,2-dimethylpyrrolidine.
| Compound Name | 2-(1-methoxyethyl)-1,2-dimethylpyrrolidine |
|---|---|
| PubChem CID | 168881311 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 2-(1-methoxyethyl)-1,2-dimethylpyrrolidine |
| SMILES | COC(C)C1(C)CCCN1C |
| InChI | InChI=1S/C9H19NO/c1-8(11-4)9(2)6-5-7-10(9)3/h8H,5-7H2,1-4H3 |
| InChIKey | FXDPIOOTZXGPQU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |