C8H15F2N — CID 123383049
2-(difluoromethyl)-1,2-dimethylpiperidine (PubChem CID 123383049) has the molecular formula C8H15F2N and a molecular weight of 163.21 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,2-dimethylpiperidine.
| Compound Name | 2-(difluoromethyl)-1,2-dimethylpiperidine |
|---|---|
| PubChem CID | 123383049 |
| Molecular Formula | C8H15F2N |
| Molecular Weight | 163.21 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | 2-(difluoromethyl)-1,2-dimethylpiperidine |
| SMILES | CN1CCCCC1(C)C(F)F |
| InChI | InChI=1S/C8H15F2N/c1-8(7(9)10)5-3-4-6-11(8)2/h7H,3-6H2,1-2H3 |
| InChIKey | YEIFKLRFZPYWDP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |