About 2-ethoxy-1,2-dimethylpiperidine;hydrochloride
2-ethoxy-1,2-dimethylpiperidine;hydrochloride (PubChem CID 174950833) has the molecular formula C9H20ClNO
and a molecular weight of 193.72 g/mol. Its IUPAC name is 2-ethoxy-1,2-dimethylpiperidine;hydrochloride.
Molecular Properties
| Compound Name | 2-ethoxy-1,2-dimethylpiperidine;hydrochloride |
| PubChem CID | 174950833 |
| Molecular Formula | C9H20ClNO |
| Molecular Weight | 193.72 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 2-ethoxy-1,2-dimethylpiperidine;hydrochloride |
| SMILES | CCOC1(C)CCCCN1C.Cl |
| InChI | InChI=1S/C9H19NO.ClH/c1-4-11-9(2)7-5-6-8-10(9)3;/h4-8H2,1-3H3;1H |
| InChIKey | SHPXVSRGCLCAKK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.72 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethoxy-1,2-dimethylpiperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-1,2-dimethylpiperidine;hydrochloride?
The IUPAC name of 2-ethoxy-1,2-dimethylpiperidine;hydrochloride (CID 174950833) is 2-ethoxy-1,2-dimethylpiperidine;hydrochloride.
What is the SMILES notation for 2-ethoxy-1,2-dimethylpiperidine;hydrochloride?
The canonical SMILES for 2-ethoxy-1,2-dimethylpiperidine;hydrochloride is CCOC1(C)CCCCN1C.Cl.
What is the InChIKey of 2-ethoxy-1,2-dimethylpiperidine;hydrochloride?
The InChIKey is SHPXVSRGCLCAKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO.ClH/c1-4-11-9(2)7-5-6-8-10(9)3;/h4-8H2,1-3H3;1H.
What are the key properties of 2-ethoxy-1,2-dimethylpiperidine;hydrochloride?
2-ethoxy-1,2-dimethylpiperidine;hydrochloride has a molecular weight of 193.72 g/mol, XLogP of 2.28, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-1,2-dimethylpiperidine;hydrochloride is sourced from PubChem (CID 174950833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).