C10H21N — CID 89025090
2-butan-2-yl-1,2-dimethylpyrrolidine (PubChem CID 89025090) has the molecular formula C10H21N and a molecular weight of 155.28 g/mol. Its IUPAC name is 2-butan-2-yl-1,2-dimethylpyrrolidine.
| Compound Name | 2-butan-2-yl-1,2-dimethylpyrrolidine |
|---|---|
| PubChem CID | 89025090 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | 2-butan-2-yl-1,2-dimethylpyrrolidine |
| SMILES | CCC(C)C1(C)CCCN1C |
| InChI | InChI=1S/C10H21N/c1-5-9(2)10(3)7-6-8-11(10)4/h9H,5-8H2,1-4H3 |
| InChIKey | TYGBYRZNTHPCNA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |