About 3-ethyl-1,2,3-trimethyldiazinane
3-ethyl-1,2,3-trimethyldiazinane (PubChem CID 178101796) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is 3-ethyl-1,2,3-trimethyldiazinane.
Molecular Properties
| Compound Name | 3-ethyl-1,2,3-trimethyldiazinane |
| PubChem CID | 178101796 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 3-ethyl-1,2,3-trimethyldiazinane |
| SMILES | CCC1(C)CCCN(C)N1C |
| InChI | InChI=1S/C9H20N2/c1-5-9(2)7-6-8-10(3)11(9)4/h5-8H2,1-4H3 |
| InChIKey | RACPHYRRPQAUAB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-1,2,3-trimethyldiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,2,3-trimethyldiazinane?
The IUPAC name of 3-ethyl-1,2,3-trimethyldiazinane (CID 178101796) is 3-ethyl-1,2,3-trimethyldiazinane.
What is the SMILES notation for 3-ethyl-1,2,3-trimethyldiazinane?
The canonical SMILES for 3-ethyl-1,2,3-trimethyldiazinane is CCC1(C)CCCN(C)N1C.
What is the InChIKey of 3-ethyl-1,2,3-trimethyldiazinane?
The InChIKey is RACPHYRRPQAUAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2/c1-5-9(2)7-6-8-10(3)11(9)4/h5-8H2,1-4H3.
What are the key properties of 3-ethyl-1,2,3-trimethyldiazinane?
3-ethyl-1,2,3-trimethyldiazinane has a molecular weight of 156.27 g/mol, XLogP of 1.73, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,2,3-trimethyldiazinane is sourced from PubChem (CID 178101796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).