C8H14N2 — CID 130291955
2-(1,2-dimethylpyrrolidin-2-yl)acetonitrile (PubChem CID 130291955) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 2-(1,2-dimethylpyrrolidin-2-yl)acetonitrile.
| Compound Name | 2-(1,2-dimethylpyrrolidin-2-yl)acetonitrile |
|---|---|
| PubChem CID | 130291955 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 2-(1,2-dimethylpyrrolidin-2-yl)acetonitrile |
| SMILES | CN1CCCC1(C)CC#N |
| InChI | InChI=1S/C8H14N2/c1-8(5-6-9)4-3-7-10(8)2/h3-5,7H2,1-2H3 |
| InChIKey | JNQUFGRSQFLAMW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |