C11H20N4O — CID 123453716
2,5-dimethyl-2,5-diazaspiro[3.4]octan-3-one;2-(methylamino)acetonitrile (PubChem CID 123453716) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 2,5-dimethyl-2,5-diazaspiro[3.4]octan-3-one;2-(methylamino)acetonitrile.
| Compound Name | 2,5-dimethyl-2,5-diazaspiro[3.4]octan-3-one;2-(methylamino)acetonitrile |
|---|---|
| PubChem CID | 123453716 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2,5-dimethyl-2,5-diazaspiro[3.4]octan-3-one;2-(methylamino)acetonitrile |
| SMILES | CN1CC2(CCCN2C)C1=O.CNCC#N |
| InChI | InChI=1S/C8H14N2O.C3H6N2/c1-9-6-8(7(9)11)4-3-5-10(8)2;1-5-3-2-4/h3-6H2,1-2H3;5H,3H2,1H3 |
| InChIKey | XOBRTVFCJLORBD-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|