C12H21N3O — CID 158540539
2,3a,7a-trimethyl-3-oxo-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridine-5-carbonitrile;methane (PubChem CID 158540539) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 2,3a,7a-trimethyl-3-oxo-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridine-5-carbonitrile;methane.
| Compound Name | 2,3a,7a-trimethyl-3-oxo-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridine-5-carbonitrile;methane |
|---|---|
| PubChem CID | 158540539 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 2,3a,7a-trimethyl-3-oxo-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridine-5-carbonitrile;methane |
| SMILES | C.CN1CC2(C)CCN(C#N)CC2(C)C1=O |
| InChI | InChI=1S/C11H17N3O.CH4/c1-10-4-5-14(8-12)7-11(10,2)9(15)13(3)6-10;/h4-7H2,1-3H3;1H4 |
| InChIKey | HOLPHHCPLCNSSO-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|