C13H15N3 — CID 154618923
spiro[2,4-dihydro-1H-quinoline-3,3'-pyrrolidine]-1'-carbonitrile (PubChem CID 154618923) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is spiro[2,4-dihydro-1H-quinoline-3,3'-pyrrolidine]-1'-carbonitrile.
| Compound Name | spiro[2,4-dihydro-1H-quinoline-3,3'-pyrrolidine]-1'-carbonitrile |
|---|---|
| PubChem CID | 154618923 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | spiro[2,4-dihydro-1H-quinoline-3,3'-pyrrolidine]-1'-carbonitrile |
| SMILES | N#CN1CCC2(CNc3ccccc3C2)C1 |
| InChI | InChI=1S/C13H15N3/c14-10-16-6-5-13(9-16)7-11-3-1-2-4-12(11)15-8-13/h1-4,15H,5-9H2 |
| InChIKey | HSEUBBMWFYENFP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|